cas: 73415-54-0 — see every product listed under this CAS number, including other names
N-Phenyl-4-piperidinecarboxamide hydrochloride 98% (CAS 73415-54-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A785755-100mg |
| cas | 73415-54-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 470.50 Pln | |
| Ambeed | 250mg | 687.44 Pln | |
| Ambeed | 1g | 2489.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A785755 |
N-phenylpiperidine-4-carboxamide;hydrochloride (CAS 73415-54-0) is a chemical compound with the molecular formula C12H17ClN2O and a molecular weight of 240.73 g/mol. IUPAC name: N-phenylpiperidine-4-carboxamide;hydrochloride. InChIKey: BOVNAQHWGKAFQU-UHFFFAOYSA-N.
| Molecular formula | C12H17ClN2O |
|---|---|
| Molecular weight | 240.73 g/mol |
| IUPAC name | N-phenylpiperidine-4-carboxamide;hydrochloride |
| InChIKey | BOVNAQHWGKAFQU-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C(=O)NC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)