cas: 2056919-55-0 — see every product listed under this CAS number, including other names
N-TERT-BUTYL-2-[3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENOXY]ACETAMIDE, 95% (CAS 2056919-55-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F844280-100MG |
| cas | 2056919-55-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 784.12 Pln | |
| Fluorochem | 250mg | 1028.82 Pln | |
| Fluorochem | 1g | 1965.99 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
N-tert-butyl-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetamide (CAS 2056919-55-0) is a chemical compound with the molecular formula C18H28BNO4 and a molecular weight of 333.2 g/mol. IUPAC name: N-tert-butyl-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetamide. InChIKey: HSMMSYYDKPSMIF-UHFFFAOYSA-N.
| Molecular formula | C18H28BNO4 |
|---|---|
| Molecular weight | 333.2 g/mol |
| IUPAC name | N-tert-butyl-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetamide |
| InChIKey | HSMMSYYDKPSMIF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)OCC(=O)NC(C)(C)C |
Computed by PubChem (NCBI)