cas: 1382358-37-3 — see every product listed under this CAS number, including other names
N-Tosylpiperidine-4-boronic acid pinacol ester, 97%, 97% (CAS 1382358-37-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HV9T-100mg |
| cas | 1382358-37-3 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 376.40 Pln | |
| Chemat | 250mg | 750.80 Pln | |
| Chemat | 500mg | 1202.00 Pln | |
| Chemat | 1g | 1778.00 Pln | |
| Chemat | 5g | 5382.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-(4-methylphenyl)sulfonyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidine (CAS 1382358-37-3) is a chemical compound with the molecular formula C18H28BNO4S and a molecular weight of 365.3 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidine. InChIKey: AENMXOFMCUYVTQ-UHFFFAOYSA-N.
| Molecular formula | C18H28BNO4S |
|---|---|
| Molecular weight | 365.3 g/mol |
| IUPAC name | 1-(4-methylphenyl)sulfonyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidine |
| InChIKey | AENMXOFMCUYVTQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2CCN(CC2)S(=O)(=O)C3=CC=C(C=C3)C |
Computed by PubChem (NCBI)