cas: 2267377-24-0 — see every product listed under this CAS number, including other names
N-cyclopentyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline, 95%, 95% (CAS 2267377-24-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FPTP-250mg |
| cas | 2267377-24-0 |
| size | 250mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 942.80 Pln | |
| Chemat | 1g | 1782.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
N-cyclopentyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 2267377-24-0) is a chemical compound with the molecular formula C17H26BNO2 and a molecular weight of 287.2 g/mol. IUPAC name: N-cyclopentyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. InChIKey: TVIWVEPXTPATEC-UHFFFAOYSA-N.
| Molecular formula | C17H26BNO2 |
|---|---|
| Molecular weight | 287.2 g/mol |
| IUPAC name | N-cyclopentyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| InChIKey | TVIWVEPXTPATEC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)NC3CCCC3 |
Computed by PubChem (NCBI)