cas: 186661-19-8 — see every product listed under this CAS number, including other names
N-dansyl-N'-ethylthiourea, 95%, 95% (CAS 186661-19-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AKFQ-100mg |
| cas | 186661-19-8 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1576.40 Pln | |
| Chemat | 250mg | 2819.60 Pln | |
| Chemat | 1g | 6952.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-[5-(dimethylamino)naphthalen-1-yl]sulfonyl-3-ethylthiourea (CAS 186661-19-8) is a chemical compound with the molecular formula C15H19N3O2S2 and a molecular weight of 337.5 g/mol. IUPAC name: 1-[5-(dimethylamino)naphthalen-1-yl]sulfonyl-3-ethylthiourea. InChIKey: YQBIVIRBVJOGQJ-UHFFFAOYSA-N.
| Molecular formula | C15H19N3O2S2 |
|---|---|
| Molecular weight | 337.5 g/mol |
| IUPAC name | 1-[5-(dimethylamino)naphthalen-1-yl]sulfonyl-3-ethylthiourea |
| InChIKey | YQBIVIRBVJOGQJ-UHFFFAOYSA-N |
| SMILES | CCNC(=S)NS(=O)(=O)C1=CC=CC2=C1C=CC=C2N(C)C |
Computed by PubChem (NCBI)