cas: 1218790-47-6 — see every product listed under this CAS number, including other names
N-tert-Butyl-1-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)methanimine 95% (CAS 1218790-47-6) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A565708-5g |
| cas | 1218790-47-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 609.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A565708 |
N-tert-butyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanimine (CAS 1218790-47-6) is a chemical compound with the molecular formula C17H26BNO2 and a molecular weight of 287.2 g/mol. IUPAC name: N-tert-butyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanimine. InChIKey: AEUHECHOAUPUBY-UHFFFAOYSA-N.
| Molecular formula | C17H26BNO2 |
|---|---|
| Molecular weight | 287.2 g/mol |
| IUPAC name | N-tert-butyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanimine |
| InChIKey | AEUHECHOAUPUBY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C=NC(C)(C)C |
Computed by PubChem (NCBI)