cas: 515834-67-0 — see every product listed under this CAS number, including other names
N2,N2,N2',N2',N7,N7,N7',N7'-Octa-p-tolyl-9,9'-spirobi[fluorene]-2,2',7,7'-tetraamine, 95%, 95% (CAS 515834-67-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DK9S-100mg |
| cas | 515834-67-0 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 237.20 Pln | |
| Chemat | 1g | 1720.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-N,2-N,2-N',2-N',7-N,7-N,7-N',7-N'-octakis(4-methylphenyl)-9,9'-spirobi[fluorene]-2,2',7,7'-tetramine (CAS 515834-67-0) is a chemical compound with the molecular formula C81H68N4 and a molecular weight of 1097.4 g/mol. IUPAC name: 2-N,2-N,2-N',2-N',7-N,7-N,7-N',7-N'-octakis(4-methylphenyl)-9,9'-spirobi[fluorene]-2,2',7,7'-tetramine. InChIKey: VMPLMOXGWULJTH-UHFFFAOYSA-N.
| Molecular formula | C81H68N4 |
|---|---|
| Molecular weight | 1097.4 g/mol |
| IUPAC name | 2-N,2-N,2-N',2-N',7-N,7-N,7-N',7-N'-octakis(4-methylphenyl)-9,9'-spirobi[fluorene]-2,2',7,7'-tetramine |
| InChIKey | VMPLMOXGWULJTH-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N(C2=CC=C(C=C2)C)C3=CC4=C(C=C3)C5=C(C46C7=C(C=CC(=C7)N(C8=CC=C(C=C8)C)C9=CC=C(C=C9)C)C1=C6C=C(C=C1)N(C1=CC=C(C=C1)C)C1=CC=C(C=C1)C)C=C(C=C5)N(C1=CC=C(C=C1)C)C1=CC=C(C=C1)C |
Computed by PubChem (NCBI)