N2,N2,N6,N6-Tetraphenylnaphthalene-2,6-diamine, 99% (CAS 111961-87-6) manufactured by Lumtec in a 5g pack.
| brand | Lumtec |
|---|---|
| catalog number | LT-N145-5g |
| cas | 111961-87-6 |
| size | 5g |
| availability | 12.11.2021: In Stock |
Ask us about this product — we're happy to help.
| purity | 99% |
|---|
2-N,2-N,6-N,6-N-tetraphenylnaphthalene-2,6-diamine (CAS 111961-87-6) is a chemical compound with the molecular formula C34H26N2 and a molecular weight of 462.6 g/mol. IUPAC name: 2-N,2-N,6-N,6-N-tetraphenylnaphthalene-2,6-diamine. InChIKey: LEXCBRKPOZULQO-UHFFFAOYSA-N.
| Molecular formula | C34H26N2 |
|---|---|
| Molecular weight | 462.6 g/mol |
| IUPAC name | 2-N,2-N,6-N,6-N-tetraphenylnaphthalene-2,6-diamine |
| InChIKey | LEXCBRKPOZULQO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC4=C(C=C3)C=C(C=C4)N(C5=CC=CC=C5)C6=CC=CC=C6 |
Computed by PubChem (NCBI)