CAS 195822-23-2 appears in our catalog under these names: LQZ–7I, LQZ-7I, N2,N3-Bis(4-fluorophenyl)quinoxaline-2,3-diamine, 99%, 99%, LQZ-7I, 99.78%, N2,N3-BIS(4-FLUOROPHENYL)QUINOXALINE-2,3-DIAMINE, ≥98%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 10mg, 10mM (in 1ml dmso), 25mg, 5mg, 50mg, 100mg, 500mg, 1mg.
2-N,3-N-bis(4-fluorophenyl)quinoxaline-2,3-diamine (CAS 195822-23-2) is a chemical compound with the molecular formula C20H14F2N4 and a molecular weight of 348.3 g/mol. IUPAC name: 2-N,3-N-bis(4-fluorophenyl)quinoxaline-2,3-diamine. InChIKey: DKPCKOKYSVPFEB-UHFFFAOYSA-N.
| Molecular formula | C20H14F2N4 |
|---|---|
| Molecular weight | 348.3 g/mol |
| IUPAC name | 2-N,3-N-bis(4-fluorophenyl)quinoxaline-2,3-diamine |
| InChIKey | DKPCKOKYSVPFEB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(C(=N2)NC3=CC=C(C=C3)F)NC4=CC=C(C=C4)F |
Computed by PubChem (NCBI)