cas: 97745-69-2 — see every product listed under this CAS number, including other names
N2,Nd,Nw-tris(tert-butoxycarbonyl)-L-arginine, 95% (CAS 97745-69-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A416024-1g |
| cas | 97745-69-2 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 714.49 Pln | |
| AmBeed | 5g | 2511.25 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
(2S)-5-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 97745-69-2) is a chemical compound with the molecular formula C21H38N4O8 and a molecular weight of 474.5 g/mol. IUPAC name: (2S)-5-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: BGOFOVHACSQSIE-ZDUSSCGKSA-N.
| Molecular formula | C21H38N4O8 |
|---|---|
| Molecular weight | 474.5 g/mol |
| IUPAC name | (2S)-5-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | BGOFOVHACSQSIE-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCN=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)