cas: 121058-82-0 — see every product listed under this CAS number, including other names
N4-Acetyl-5’-O-(4,4’-dimethoxytrityl)-2’-deoxycytidine 95% (CAS 121058-82-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A461102-250mg |
| cas | 121058-82-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 325.88 Pln | |
| Ambeed | 5g | 848.75 Pln | |
| Ambeed | 10g | 1321.56 Pln | |
| Ambeed | 25g | 2578.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A461102 |
N-[1-[(2R,3R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3,4-dihydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide (CAS 121058-82-0) is a chemical compound with the molecular formula C32H33N3O8 and a molecular weight of 587.6 g/mol. IUPAC name: N-[1-[(2R,3R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3,4-dihydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide. InChIKey: AFQGZOMSSIQDMD-PYYPWFDZSA-N.
| Molecular formula | C32H33N3O8 |
|---|---|
| Molecular weight | 587.6 g/mol |
| IUPAC name | N-[1-[(2R,3R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3,4-dihydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide |
| InChIKey | AFQGZOMSSIQDMD-PYYPWFDZSA-N |
| SMILES | CC(=O)NC1=NC(=O)N(C=C1)[C@H]2[C@@H]([C@@H]([C@H](O2)COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC)O)O |
Computed by PubChem (NCBI)