cas: 200115-86-2 — see every product listed under this CAS number, including other names
N5-[[[(2,3-Dihydro-2,2,4,6,7-pentamethyl-5-benzofuranyl)sulfonyl]amino]iminomethyl]-L-ornithine, 97% (hydrate) (CAS 200115-86-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113CK2-100mg |
| cas | 200115-86-2 |
| size | 100mg |
| availability | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 107.60 Pln | |
| Chemat | 10g | 141.20 Pln | |
| Chemat | 25g | 232.40 Pln | |
| Chemat | 50g | 366.80 Pln | |
| Chemat | 100g | 611.60 Pln | |
| Chemat | 250g | 1418.00 Pln | |
| Chemat | 500g | 2798.40 Pln |
| purity | 97% (hydrate) |
|---|---|
| delivery time | 3 weeks |
(2S)-2-amino-5-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]pentanoic acid (CAS 200115-86-2) is a chemical compound with the molecular formula C19H30N4O5S and a molecular weight of 426.5 g/mol. IUPAC name: (2S)-2-amino-5-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]pentanoic acid. InChIKey: GVIXTVCDNCXXSH-AWEZNQCLSA-N.
| Molecular formula | C19H30N4O5S |
|---|---|
| Molecular weight | 426.5 g/mol |
| IUPAC name | (2S)-2-amino-5-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]pentanoic acid |
| InChIKey | GVIXTVCDNCXXSH-AWEZNQCLSA-N |
| SMILES | CC1=C(C(=C(C2=C1OC(C2)(C)C)C)S(=O)(=O)NC(=NCCC[C@@H](C(=O)O)N)N)C |
Computed by PubChem (NCBI)