CAS 5977-09-3 appears in our catalog under these names: H-Lys(isopropyl)-OH, H-Lysine(Isopropyl)-OH, H–Lys(isopropyl)–OH, H-Lys(iPr)-OH 98% （Contains 5% acetic acid）, N6-(1-Methylethyl)-L-lysine, 98% （Contains 5% acetic acid）, 98% （Contains 5% acetic acid）. Offered by: Creative Peptides, TRC, GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
(2S)-2-amino-6-(propan-2-ylamino)hexanoic acid (CAS 5977-09-3) is a chemical compound with the molecular formula C9H20N2O2 and a molecular weight of 188.27 g/mol. IUPAC name: (2S)-2-amino-6-(propan-2-ylamino)hexanoic acid. InChIKey: CBAWNLIZBXJSFS-QMMMGPOBSA-N.
| Molecular formula | C9H20N2O2 |
|---|---|
| Molecular weight | 188.27 g/mol |
| IUPAC name | (2S)-2-amino-6-(propan-2-ylamino)hexanoic acid |
| InChIKey | CBAWNLIZBXJSFS-QMMMGPOBSA-N |
| SMILES | CC(C)NCCCC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)