cas: 1599432-08-2 — see every product listed under this CAS number, including other names
NIBR189 (CAS 1599432-08-2) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1g, 500mg. Offered by: TargetMol, GLPBio, Biosynth.
| brand | TargetMol |
|---|---|
| catalog number | T7156-5mg |
| cas | 1599432-08-2 |
| size | 5mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| TargetMol | 5mg | 499.07 Pln | |
| TargetMol | 10mg | 718.19 Pln | |
| TargetMol | 25mg | 1176.01 Pln | |
| TargetMol | 50mg | 1920.04 Pln | |
| TargetMol | 100mg | 2736.74 Pln | |
| TargetMol | 200mg | 3812.82 Pln | |
| GLPBio | 10mg | 798.30 Pln | |
| GLPBio | 1g | 7645.87 Pln | |
| GLPBio | 50mg | 1860.77 Pln | |
| GLPBio | 500mg | 5235.42 Pln | |
| Biosynth | 50mg | price on request | |
| Biosynth | 0,5g | price on request |
| purity | No data |
|---|---|
| delivery time | approx. 15 days |
(E)-3-(4-bromophenyl)-1-[4-(4-methoxybenzoyl)piperazin-1-yl]prop-2-en-1-one (CAS 1599432-08-2) is a chemical compound with the molecular formula C21H21BrN2O3 and a molecular weight of 429.3 g/mol. IUPAC name: (E)-3-(4-bromophenyl)-1-[4-(4-methoxybenzoyl)piperazin-1-yl]prop-2-en-1-one. InChIKey: OFHXXBRBGWUOHR-NYYWCZLTSA-N.
| Molecular formula | C21H21BrN2O3 |
|---|---|
| Molecular weight | 429.3 g/mol |
| IUPAC name | (E)-3-(4-bromophenyl)-1-[4-(4-methoxybenzoyl)piperazin-1-yl]prop-2-en-1-one |
| InChIKey | OFHXXBRBGWUOHR-NYYWCZLTSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)N2CCN(CC2)C(=O)/C=C/C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)