cas: 700878-19-9 — see every product listed under this CAS number, including other names
NMDA-IN-1 98+% (CAS 700878-19-9) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A607428-5mg |
| cas | 700878-19-9 |
| size | 5mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5mg | 537.25 Pln | |
| Ambeed | 10mg | 865.44 Pln | |
| Ambeed | 25mg | 1855.56 Pln | |
| Ambeed | 50mg | 3274.00 Pln |
| purity | 98+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A607428 |
2-[[4-[(2-fluorophenyl)methyl]piperidin-1-yl]methyl]-3H-benzimidazol-5-ol;dihydrochloride (CAS 700878-19-9) is a chemical compound with the molecular formula C20H24Cl2FN3O and a molecular weight of 412.3 g/mol. IUPAC name: 2-[[4-[(2-fluorophenyl)methyl]piperidin-1-yl]methyl]-3H-benzimidazol-5-ol;dihydrochloride. InChIKey: JYUWGWCFJMDMND-UHFFFAOYSA-N.
| Molecular formula | C20H24Cl2FN3O |
|---|---|
| Molecular weight | 412.3 g/mol |
| IUPAC name | 2-[[4-[(2-fluorophenyl)methyl]piperidin-1-yl]methyl]-3H-benzimidazol-5-ol;dihydrochloride |
| InChIKey | JYUWGWCFJMDMND-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1CC2=CC=CC=C2F)CC3=NC4=C(N3)C=C(C=C4)O.Cl.Cl |
Computed by PubChem (NCBI)