cas: 56932-43-5 — see every product listed under this CAS number, including other names
NSC-87877 disodium 96% (CAS 56932-43-5) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A236181-1mg |
| cas | 56932-43-5 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 120.06 Pln | |
| Ambeed | 5mg | 147.88 Pln | |
| Ambeed | 10mg | 197.94 Pln | |
| Ambeed | 25mg | 303.62 Pln | |
| Ambeed | 50mg | 470.50 Pln | |
| Ambeed | 100mg | 743.06 Pln | |
| Ambeed | 250mg | 1277.06 Pln | |
| Ambeed | 1g | 3190.56 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A236181 |
Disodium;8-hydroxy-7-[(6-sulfonatonaphthalen-2-yl)diazenyl]quinoline-5-sulfonate (CAS 56932-43-5) is a chemical compound with the molecular formula C19H11N3Na2O7S2 and a molecular weight of 503.4 g/mol. IUPAC name: disodium;8-hydroxy-7-[(6-sulfonatonaphthalen-2-yl)diazenyl]quinoline-5-sulfonate. InChIKey: IFVGQKHFUZRWNA-UHFFFAOYSA-L.
| Molecular formula | C19H11N3Na2O7S2 |
|---|---|
| Molecular weight | 503.4 g/mol |
| IUPAC name | disodium;8-hydroxy-7-[(6-sulfonatonaphthalen-2-yl)diazenyl]quinoline-5-sulfonate |
| InChIKey | IFVGQKHFUZRWNA-UHFFFAOYSA-L |
| SMILES | C1=CC2=C(C=C(C(=C2N=C1)O)N=NC3=CC4=C(C=C3)C=C(C=C4)S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)