cas: 839713-36-9 — see every product listed under this CAS number, including other names
Nelotanserin 99% (CAS 839713-36-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A101038-50mg |
| cas | 839713-36-9 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 921.06 Pln | |
| Ambeed | 100mg | 1605.25 Pln | |
| Ambeed | 250mg | 3068.19 Pln | |
| Ambeed | 1g | 8141.19 Pln |
| purity | 99% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A101038 |
Nelotanserin is a member of pyrazoles and a ring assembly.
Source: ChEBI
| Molecular formula | C18H15BrF2N4O2 |
|---|---|
| Molecular weight | 437.2 g/mol |
| IUPAC name | 1-[3-(4-bromo-1-methylpyrazol-5-yl)-4-methoxyphenyl]-3-(2,4-difluorophenyl)urea |
| InChIKey | COSPVUFTLGQDQL-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C=N1)Br)C2=C(C=CC(=C2)NC(=O)NC3=C(C=C(C=C3)F)F)OC |
Computed by PubChem (NCBI)