cas: 123410-65-1 — see every product listed under this CAS number, including other names
Neochlorogenic acid methyl ester (CAS 123410-65-1) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 10mg, 100mg, 2mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg. Offered by: GLPBio, Biosynth, Chemat.
| brand | GLPBio |
|---|---|
| catalog number | GF05704-1 |
| cas | 123410-65-1 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1mg | 728.09 Pln | |
| GLPBio | 10mg | 1388.04 Pln | |
| GLPBio | 100mg | 4084.01 Pln | |
| GLPBio | 2mg | 868.51 Pln | |
| GLPBio | 25mg | 2165.01 Pln | |
| GLPBio | 5mg | 1060.41 Pln | |
| GLPBio | 10mM (in 1ml dmso) | 1083.81 Pln | |
| GLPBio | 50mg | 2988.78 Pln | |
| Biosynth | 5mg | price on request | |
| Biosynth | 25mg | price on request | |
| Biosynth | 10mg | price on request | |
| Biosynth | 100mg | price on request | |
| Biosynth | 50mg | price on request | |
| Chemat | 1mg | 434.00 Pln | |
| Chemat | 2mg | 611.60 Pln | |
| Chemat | 5mg | 846.80 Pln | |
| Chemat | 10mg | 1245.20 Pln | |
| Chemat | 20mg | 1840.40 Pln | |
| Chemat | 25mg | 2200.40 Pln | |
| Chemat | 50mg | 3208.40 Pln | |
| Chemat | 100mg | 4552.40 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl (1R,3R,4S,5R)-3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-1,4,5-trihydroxycyclohexane-1-carboxylate (CAS 123410-65-1) is a chemical compound with the molecular formula C17H20O9 and a molecular weight of 368.3 g/mol. IUPAC name: methyl (1R,3R,4S,5R)-3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-1,4,5-trihydroxycyclohexane-1-carboxylate. InChIKey: MZNIJRAPCCELQX-NYCIAPANSA-N.
| Molecular formula | C17H20O9 |
|---|---|
| Molecular weight | 368.3 g/mol |
| IUPAC name | methyl (1R,3R,4S,5R)-3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-1,4,5-trihydroxycyclohexane-1-carboxylate |
| InChIKey | MZNIJRAPCCELQX-NYCIAPANSA-N |
| SMILES | COC(=O)[C@]1(C[C@H]([C@@H]([C@@H](C1)OC(=O)/C=C/C2=CC(=C(C=C2)O)O)O)O)O |
Computed by PubChem (NCBI)