CAS 14248-15-8 appears in our catalog under these names: Neopentyl 4-bromobenzenesulfonate, 98%, Neopentyl 4-bromobenzenesulfonate 95%, Neopentyl 4-Bromobenzenesulfonate, >95%, >95%, Neopentyl 4-bromobenzenesulfonate, >95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 25g.
2,2-dimethylpropyl 4-bromobenzenesulfonate (CAS 14248-15-8) is a chemical compound with the molecular formula C11H15BrO3S and a molecular weight of 307.21 g/mol. IUPAC name: 2,2-dimethylpropyl 4-bromobenzenesulfonate. InChIKey: PVJBARUAGAVJSY-UHFFFAOYSA-N.
| Molecular formula | C11H15BrO3S |
|---|---|
| Molecular weight | 307.21 g/mol |
| IUPAC name | 2,2-dimethylpropyl 4-bromobenzenesulfonate |
| InChIKey | PVJBARUAGAVJSY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)COS(=O)(=O)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)