cas: 934628-27-0 — see every product listed under this CAS number, including other names
Nilofabicin 99% (CAS 934628-27-0) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A296988-25mg |
| cas | 934628-27-0 |
| size | 25mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25mg | 381.50 Pln | |
| Ambeed | 50mg | 448.25 Pln | |
| Ambeed | 100mg | 526.12 Pln | |
| Ambeed | 250mg | 854.31 Pln |
| purity | 99% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A296988 |
1-[(3-amino-2-methylphenyl)methyl]-4-(2-thiophen-2-ylethoxy)pyridin-2-one (CAS 934628-27-0) is a chemical compound with the molecular formula C19H20N2O2S and a molecular weight of 340.4 g/mol. IUPAC name: 1-[(3-amino-2-methylphenyl)methyl]-4-(2-thiophen-2-ylethoxy)pyridin-2-one. InChIKey: YCLREGRRHGLOAK-UHFFFAOYSA-N.
| Molecular formula | C19H20N2O2S |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | 1-[(3-amino-2-methylphenyl)methyl]-4-(2-thiophen-2-ylethoxy)pyridin-2-one |
| InChIKey | YCLREGRRHGLOAK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1N)CN2C=CC(=CC2=O)OCCC3=CC=CS3 |
Computed by PubChem (NCBI)