cas: 13063-04-2 — see every product listed under this CAS number, including other names
Nitidine chloride (CAS 13063-04-2) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 20mg, 5mg. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GN10757-10 |
| cas | 13063-04-2 |
| size | 10mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10mg | 1004.24 Pln | |
| GLPBio | 20mg | 1383.36 Pln | |
| GLPBio | 5mg | 751.50 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
2,3-dimethoxy-12-methyl-[1,3]benzodioxolo[5,6-c]phenanthridin-12-ium chloride (CAS 13063-04-2) is a chemical compound with the molecular formula C21H18ClNO4 and a molecular weight of 383.8 g/mol. IUPAC name: 2,3-dimethoxy-12-methyl-[1,3]benzodioxolo[5,6-c]phenanthridin-12-ium chloride. InChIKey: QLDAACVSUMUMOR-UHFFFAOYSA-M.
| Molecular formula | C21H18ClNO4 |
|---|---|
| Molecular weight | 383.8 g/mol |
| IUPAC name | 2,3-dimethoxy-12-methyl-[1,3]benzodioxolo[5,6-c]phenanthridin-12-ium chloride |
| InChIKey | QLDAACVSUMUMOR-UHFFFAOYSA-M |
| SMILES | C[N+]1=CC2=CC(=C(C=C2C3=C1C4=CC5=C(C=C4C=C3)OCO5)OC)OC.[Cl-] |
Computed by PubChem (NCBI)