cas: 200132-54-3 — see every product listed under this CAS number, including other names
O(9)-Allyl-N-9-anthracenylcinchonidinium bromide, 98%, 98% (CAS 200132-54-3) is a chemical reagent available from Chemat. Available pack sizes: 50g, 250g, 500g, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113CKF-50g |
| cas | 200132-54-3 |
| size | 50g |
| availability | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 1749.20 Pln | |
| Chemat | 250g | 4485.20 Pln | |
| Chemat | 500g | 8246.40 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 237.20 Pln | |
| Chemat | 10g | 410.00 Pln | |
| Chemat | 25g | 923.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-[[1-(anthracen-9-ylmethyl)-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-prop-2-enoxymethyl]quinoline bromide (CAS 200132-54-3) is a chemical compound with the molecular formula C37H37BrN2O and a molecular weight of 605.6 g/mol. IUPAC name: 4-[[1-(anthracen-9-ylmethyl)-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-prop-2-enoxymethyl]quinoline bromide. InChIKey: QOWNPAUSLGATNL-UHFFFAOYSA-M.
| Molecular formula | C37H37BrN2O |
|---|---|
| Molecular weight | 605.6 g/mol |
| IUPAC name | 4-[[1-(anthracen-9-ylmethyl)-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-prop-2-enoxymethyl]quinoline bromide |
| InChIKey | QOWNPAUSLGATNL-UHFFFAOYSA-M |
| SMILES | C=CCOC(C1CC2CC[N+]1(CC2C=C)CC3=C4C=CC=CC4=CC5=CC=CC=C53)C6=CC=NC7=CC=CC=C67.[Br-] |
Computed by PubChem (NCBI)