cas: 944283-25-4 — see every product listed under this CAS number, including other names
O-((((9H-fluoren-9-yl)methoxy)carbonyl)glycyl)-N-(tert-butoxycarbonyl)-L-threonine, ≥95%, ≥95% (CAS 944283-25-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11VQY8-1g |
| cas | 944283-25-4 |
| size | 1g |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 539.60 Pln | |
| Chemat | 5g | 1643.60 Pln | |
| Chemat | 10g | 2699.60 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
(2S,3R)-3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 944283-25-4) is a chemical compound with the molecular formula C26H30N2O8 and a molecular weight of 498.5 g/mol. IUPAC name: (2S,3R)-3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: FKRTXLMOZHWXCJ-QRQCRPRQSA-N.
| Molecular formula | C26H30N2O8 |
|---|---|
| Molecular weight | 498.5 g/mol |
| IUPAC name | (2S,3R)-3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | FKRTXLMOZHWXCJ-QRQCRPRQSA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)NC(=O)OC(C)(C)C)OC(=O)CNC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)