cas: 103587-51-5 — see every product listed under this CAS number, including other names
O-(tert-Butyldiphenylsilyl)hydroxylamine, 98%, 98% (CAS 103587-51-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114TF2-250mg |
| cas | 103587-51-5 |
| size | 250mg |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 136.40 Pln | |
| Chemat | 5g | 424.40 Pln | |
| Chemat | 10g | 784.40 Pln | |
| Chemat | 25g | 1504.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
O-[tert-butyl(diphenyl)silyl]hydroxylamine (CAS 103587-51-5) is a chemical compound with the molecular formula C16H21NOSi and a molecular weight of 271.43 g/mol. IUPAC name: O-[tert-butyl(diphenyl)silyl]hydroxylamine. InChIKey: PWTWOGMXABHJOA-UHFFFAOYSA-N.
| Molecular formula | C16H21NOSi |
|---|---|
| Molecular weight | 271.43 g/mol |
| IUPAC name | O-[tert-butyl(diphenyl)silyl]hydroxylamine |
| InChIKey | PWTWOGMXABHJOA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C1=CC=CC=C1)(C2=CC=CC=C2)ON |
Computed by PubChem (NCBI)