cas: 503612-76-8 — see every product listed under this CAS number, including other names
O-Desmethyl apixaban 99% (CAS 503612-76-8) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1157722-10mg |
| cas | 503612-76-8 |
| size | 10mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10mg | 403.75 Pln | |
| Ambeed | 25mg | 698.56 Pln | |
| Ambeed | 50mg | 1265.94 Pln | |
| Ambeed | 100mg | 1694.25 Pln | |
| Ambeed | 250mg | 2990.31 Pln | |
| Ambeed | 1g | 7963.19 Pln |
| purity | 99% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1157722 |
1-(4-hydroxyphenyl)-7-oxo-6-[4-(2-oxopiperidin-1-yl)phenyl]-4,5-dihydropyrazolo[5,4-c]pyridine-3-carboxamide (CAS 503612-76-8) is a chemical compound with the molecular formula C24H23N5O4 and a molecular weight of 445.5 g/mol. IUPAC name: 1-(4-hydroxyphenyl)-7-oxo-6-[4-(2-oxopiperidin-1-yl)phenyl]-4,5-dihydropyrazolo[5,4-c]pyridine-3-carboxamide. InChIKey: HGHLWAZFIGRAOT-UHFFFAOYSA-N.
| Molecular formula | C24H23N5O4 |
|---|---|
| Molecular weight | 445.5 g/mol |
| IUPAC name | 1-(4-hydroxyphenyl)-7-oxo-6-[4-(2-oxopiperidin-1-yl)phenyl]-4,5-dihydropyrazolo[5,4-c]pyridine-3-carboxamide |
| InChIKey | HGHLWAZFIGRAOT-UHFFFAOYSA-N |
| SMILES | C1CCN(C(=O)C1)C2=CC=C(C=C2)N3CCC4=C(C3=O)N(N=C4C(=O)N)C5=CC=C(C=C5)O |
Computed by PubChem (NCBI)