O2-tert-butyl O3-ethyl (1S,3S,4S)-5,5-difluoro-2-azabicyclo[2.2.2]octane-2,3-dicarboxylate, 95%
cas: 2380651-53-4 — see every product listed under this CAS number, including other names
O2-tert-butyl O3-ethyl (1S,3S,4S)-5,5-difluoro-2-azabicyclo[2.2.2]octane-2,3-dicarboxylate, 95% (CAS 2380651-53-4) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g, 500mg, 5g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch138IT7-25mg |
| cas | 2380651-53-4 |
| size | 25mg |
| availability | 7g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 285.20 Pln | |
| Chemat | 50mg | 434.00 Pln | |
| Chemat | 100mg | 678.80 Pln | |
| Chemat | 250mg | 1091.60 Pln | |
| Chemat | 1g | 2632.40 Pln | |
| Fluorochem | 100mg | 914.28 Pln | |
| Fluorochem | 250mg | 1476.58 Pln | |
| Fluorochem | 500mg | 2866.72 Pln | |
| Fluorochem | 1g | 3527.94 Pln | |
| Fluorochem | 5g | 17085.67 Pln | |
| Fluorochem | 25mg | 367.60 Pln | |
| Fluorochem | 50mg | 575.86 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-O-tert-butyl 3-O-ethyl (1S,3S,4S)-5,5-difluoro-2-azabicyclo[2.2.2]octane-2,3-dicarboxylate (CAS 2380651-53-4) is a chemical compound with the molecular formula C15H23F2NO4 and a molecular weight of 319.34 g/mol. IUPAC name: 2-O-tert-butyl 3-O-ethyl (1S,3S,4S)-5,5-difluoro-2-azabicyclo[2.2.2]octane-2,3-dicarboxylate. InChIKey: ITEAXDCAQXHQHV-DCAQKATOSA-N.
| Molecular formula | C15H23F2NO4 |
|---|---|
| Molecular weight | 319.34 g/mol |
| IUPAC name | 2-O-tert-butyl 3-O-ethyl (1S,3S,4S)-5,5-difluoro-2-azabicyclo[2.2.2]octane-2,3-dicarboxylate |
| InChIKey | ITEAXDCAQXHQHV-DCAQKATOSA-N |
| SMILES | CCOC(=O)[C@@H]1[C@@H]2CC[C@H](N1C(=O)OC(C)(C)C)CC2(F)F |
Computed by PubChem (NCBI)