cas: 79517-01-4 — see every product listed under this CAS number, including other names
Octreotide xAcetate, 99% (CAS 79517-01-4) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch120FSF-1mg |
| cas | 79517-01-4 |
| size | 1mg |
| availability | 5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 107.60 Pln | |
| Chemat | 5mg | 179.60 Pln | |
| Chemat | 10mg | 246.80 Pln | |
| Chemat | 50mg | 621.20 Pln | |
| Chemat | 100mg | 923.60 Pln | |
| Chemat | 250mg | 1874.00 Pln | |
| Chemat | 1g | 4950.80 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
Acetic acid;(4R,7S,10S,13R,16S,19R)-10-(4-aminobutyl)-19-[[(2R)-2-amino-3-phenylpropanoyl]amino]-16-benzyl-N-[(2R,3R)-1,3-dihydroxybutan-2-yl]-7-[(1R)-1-hydroxyethyl]-13-(1H-indol-3-ylmethyl)-6,9,12,15,18-pentaoxo-1,2-dithia-5,8,11,14,17-pentazacycloicosane-4-carboxamide (CAS 79517-01-4) is a chemical compound with the molecular formula C53H74N10O14S2 and a molecular weight of 1139.3 g/mol. IUPAC name: acetic acid;(4R,7S,10S,13R,16S,19R)-10-(4-aminobutyl)-19-[[(2R)-2-amino-3-phenylpropanoyl]amino]-16-benzyl-N-[(2R,3R)-1,3-dihydroxybutan-2-yl]-7-[(1R)-1-hydroxyethyl]-13-(1H-indol-3-ylmethyl)-6,9,12,15,18-pentaoxo-1,2-dithia-5,8,11,14,17-pentazacycloicosane-4-carboxamide. InChIKey: QWFYIFWTVZFPRY-LODIGNQBSA-N.
| Molecular formula | C53H74N10O14S2 |
|---|---|
| Molecular weight | 1139.3 g/mol |
| IUPAC name | acetic acid;(4R,7S,10S,13R,16S,19R)-10-(4-aminobutyl)-19-[[(2R)-2-amino-3-phenylpropanoyl]amino]-16-benzyl-N-[(2R,3R)-1,3-dihydroxybutan-2-yl]-7-[(1R)-1-hydroxyethyl]-13-(1H-indol-3-ylmethyl)-6,9,12,15,18-pentaoxo-1,2-dithia-5,8,11,14,17-pentazacycloicosane-4-carboxamide |
| InChIKey | QWFYIFWTVZFPRY-LODIGNQBSA-N |
| SMILES | C[C@H]([C@H]1C(=O)N[C@@H](CSSC[C@@H](C(=O)N[C@H](C(=O)N[C@@H](C(=O)N[C@H](C(=O)N1)CCCCN)CC2=CNC3=CC=CC=C32)CC4=CC=CC=C4)NC(=O)[C@@H](CC5=CC=CC=C5)N)C(=O)N[C@H](CO)[C@@H](C)O)O.CC(=O)O.CC(=O)O |
Computed by PubChem (NCBI)