cas: 82494-08-4 — see every product listed under this CAS number, including other names
Octyl 4–O–a–D–glucopyranosyl–b–D–glucopyranoside (CAS 82494-08-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 10g, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GB60308-100 |
| cas | 82494-08-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 634.48 Pln | |
| GLPBio | 10g | 6396.18 Pln | |
| GLPBio | 1g | 1210.19 Pln | |
| GLPBio | 250mg | 793.62 Pln | |
| GLPBio | 5g | 3990.40 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
(2R,3R,4S,5S,6R)-2-[(2R,3S,4R,5R,6R)-4,5-dihydroxy-2-(hydroxymethyl)-6-octoxyoxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol (CAS 82494-08-4) is a chemical compound with the molecular formula C20H38O11 and a molecular weight of 454.5 g/mol. IUPAC name: (2R,3R,4S,5S,6R)-2-[(2R,3S,4R,5R,6R)-4,5-dihydroxy-2-(hydroxymethyl)-6-octoxyoxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol. InChIKey: MASIZQYHVMQQKI-OIIXUNCGSA-N.
| Molecular formula | C20H38O11 |
|---|---|
| Molecular weight | 454.5 g/mol |
| IUPAC name | (2R,3R,4S,5S,6R)-2-[(2R,3S,4R,5R,6R)-4,5-dihydroxy-2-(hydroxymethyl)-6-octoxyoxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| InChIKey | MASIZQYHVMQQKI-OIIXUNCGSA-N |
| SMILES | CCCCCCCCO[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O[C@@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)O)O |
Computed by PubChem (NCBI)