cas: 176219-04-8 — see every product listed under this CAS number, including other names
Omeprazole N-Oxide 99% (CAS 176219-04-8) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 25mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A527576-1mg |
| cas | 176219-04-8 |
| size | 1mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 147.88 Pln | |
| Ambeed | 5mg | 209.06 Pln | |
| Ambeed | 25mg | 264.69 Pln | |
| Ambeed | 100mg | 309.19 Pln | |
| Ambeed | 250mg | 476.06 Pln | |
| Ambeed | 1g | 1249.25 Pln |
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A527576 |
6-methoxy-2-[(4-methoxy-3,5-dimethyl-1-oxidopyridin-1-ium-2-yl)methylsulfinyl]-1H-benzimidazole (CAS 176219-04-8) is a chemical compound with the molecular formula C17H19N3O4S and a molecular weight of 361.4 g/mol. IUPAC name: 6-methoxy-2-[(4-methoxy-3,5-dimethyl-1-oxidopyridin-1-ium-2-yl)methylsulfinyl]-1H-benzimidazole. InChIKey: QZVDQETYNOBUPJ-UHFFFAOYSA-N.
| Molecular formula | C17H19N3O4S |
|---|---|
| Molecular weight | 361.4 g/mol |
| IUPAC name | 6-methoxy-2-[(4-methoxy-3,5-dimethyl-1-oxidopyridin-1-ium-2-yl)methylsulfinyl]-1H-benzimidazole |
| InChIKey | QZVDQETYNOBUPJ-UHFFFAOYSA-N |
| SMILES | CC1=C[N+](=C(C(=C1OC)C)CS(=O)C2=NC3=C(N2)C=C(C=C3)OC)[O-] |
Computed by PubChem (NCBI)