CAS 1191921-01-3 appears in our catalog under these names: Oseltamivir–acetate, Oseltamivir-acetate, Oseltamivir-acetate, 98%, 98%, Oseltamivir-acetate, 99.52%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 25mg, 2mg, 25 mg.
Ethyl (3R,4R,5S)-4,5-diacetamido-3-pentan-3-yloxycyclohexene-1-carboxylate (CAS 1191921-01-3) is a chemical compound with the molecular formula C18H30N2O5 and a molecular weight of 354.4 g/mol. IUPAC name: ethyl (3R,4R,5S)-4,5-diacetamido-3-pentan-3-yloxycyclohexene-1-carboxylate. InChIKey: IWASCEKXRLUKKH-GVDBMIGSSA-N.
| Molecular formula | C18H30N2O5 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | ethyl (3R,4R,5S)-4,5-diacetamido-3-pentan-3-yloxycyclohexene-1-carboxylate |
| InChIKey | IWASCEKXRLUKKH-GVDBMIGSSA-N |
| SMILES | CCC(CC)O[C@@H]1C=C(C[C@@H]([C@H]1NC(=O)C)NC(=O)C)C(=O)OCC |
Computed by PubChem (NCBI)