CAS 5994-87-6 appears in our catalog under these names: Diphenylphosphinamide, Diphenylphosphinamide, 98% , P,P-Diphenylphosphinic amide, 97%, 97%, P,P-Diphenylphosphinic amide, 97%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Sigma-Aldrich, Chemat, Ambeed. Available pack sizes: 100g, 25g, 5g, 1G, 250mg, 10g.
[amino(phenyl)phosphoryl]benzene (CAS 5994-87-6) is a chemical compound with the molecular formula C12H12NOP and a molecular weight of 217.20 g/mol. IUPAC name: [amino(phenyl)phosphoryl]benzene. InChIKey: RIGIWEGXTTUCIQ-UHFFFAOYSA-N.
| Molecular formula | C12H12NOP |
|---|---|
| Molecular weight | 217.20 g/mol |
| IUPAC name | [amino(phenyl)phosphoryl]benzene |
| InChIKey | RIGIWEGXTTUCIQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(=O)(C2=CC=CC=C2)N |
Computed by PubChem (NCBI)