cas: 1050500-41-8 — see every product listed under this CAS number, including other names
PEG13-Tos, 95%, 95% (CAS 1050500-41-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HAKN-100mg |
| cas | 1050500-41-8 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 362.00 Pln | |
| Chemat | 250mg | 693.20 Pln | |
| Chemat | 1g | 1437.20 Pln | |
| Chemat | 5g | 4782.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate (CAS 1050500-41-8) is a chemical compound with the molecular formula C31H56O15S and a molecular weight of 700.8 g/mol. IUPAC name: 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate. InChIKey: CXFHSAUILDFVJJ-UHFFFAOYSA-N.
| Molecular formula | C31H56O15S |
|---|---|
| Molecular weight | 700.8 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
| InChIKey | CXFHSAUILDFVJJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCO |
Computed by PubChem (NCBI)