PF-04802367
cas: 1962178-27-3 — see every product listed under this CAS number, including other names
PF-04802367 (CAS 1962178-27-3) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg. Offered by: TargetMol, Chemat.
| brand | TargetMol |
|---|---|
| catalog number | T9611-1mg |
| cas | 1962178-27-3 |
| size | 1mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| TargetMol | 1mg | 472.23 Pln | |
| TargetMol | 5mg | 870.80 Pln | |
| TargetMol | 10mg | 1222.97 Pln | |
| TargetMol | 25mg | 2046.38 Pln | |
| TargetMol | 50mg | 2989.41 Pln | |
| TargetMol | 100mg | 3932.44 Pln | |
| TargetMol | 200mg | 5134.29 Pln | |
| Chemat | 1mg | 362.00 Pln | |
| Chemat | 5mg | 803.60 Pln | |
| Chemat | 10mg | 1178.00 Pln | |
| Chemat | 25mg | 2085.20 Pln | |
| Chemat | 50mg | 3107.60 Pln | |
| Chemat | 100mg | 4168.40 Pln | |
| Chemat | 200mg | 5483.60 Pln |
properties
| purity | No data |
|---|---|
| delivery time | approx. 15 days |
5-(3-chloro-4-methoxyphenyl)-N-[3-(1,2,4-triazol-1-yl)propyl]-1,3-oxazole-4-carboxamide (CAS 1962178-27-3) is a chemical compound with the molecular formula C16H16ClN5O3 and a molecular weight of 361.78 g/mol. IUPAC name: 5-(3-chloro-4-methoxyphenyl)-N-[3-(1,2,4-triazol-1-yl)propyl]-1,3-oxazole-4-carboxamide. InChIKey: RQFYFNAGNBUGFC-UHFFFAOYSA-N.
| Molecular formula | C16H16ClN5O3 |
|---|---|
| Molecular weight | 361.78 g/mol |
| IUPAC name | 5-(3-chloro-4-methoxyphenyl)-N-[3-(1,2,4-triazol-1-yl)propyl]-1,3-oxazole-4-carboxamide |
| InChIKey | RQFYFNAGNBUGFC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=C(N=CO2)C(=O)NCCCN3C=NC=N3)Cl |
Computed by PubChem (NCBI)
Synonyms:
starbld0046821, orb1297983