cas: 89996-01-0 — see every product listed under this CAS number, including other names
PHOSPHONIUM, (3-AMINOPROPYL)TRIPHENYL-, BROMIDE, 98% (CAS 89996-01-0) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F817500-5MG |
| cas | 89996-01-0 |
| size | 5mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5mg | 320.74 Pln | |
| Fluorochem | 100mg | 419.66 Pln | |
| Fluorochem | 250mg | 732.05 Pln | |
| Fluorochem | 1g | 1658.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-aminopropyl(triphenyl)phosphanium bromide (CAS 89996-01-0) is a chemical compound with the molecular formula C21H23BrNP and a molecular weight of 400.3 g/mol. IUPAC name: 3-aminopropyl(triphenyl)phosphanium bromide. InChIKey: UPYKKMDXNPTXPZ-UHFFFAOYSA-M.
| Molecular formula | C21H23BrNP |
|---|---|
| Molecular weight | 400.3 g/mol |
| IUPAC name | 3-aminopropyl(triphenyl)phosphanium bromide |
| InChIKey | UPYKKMDXNPTXPZ-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)[P+](CCCN)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-] |
Computed by PubChem (NCBI)