cas: 813425-83-1 — see every product listed under this CAS number, including other names
Palonosetron N–oxide (CAS 813425-83-1) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 10mg, 25mg, 5mg. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GC49184-1 |
| cas | 813425-83-1 |
| size | 1mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1mg | 1046.37 Pln | |
| GLPBio | 10mg | 4851.61 Pln | |
| GLPBio | 25mg | 9915.92 Pln | |
| GLPBio | 5mg | 2951.33 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
(3aS)-2-[(3S)-1-oxido-1-azoniabicyclo[2.2.2]octan-3-yl]-3a,4,5,6-tetrahydro-3H-benzo[de]isoquinolin-1-one (CAS 813425-83-1) is a chemical compound with the molecular formula C19H24N2O2 and a molecular weight of 312.4 g/mol. IUPAC name: (3aS)-2-[(3S)-1-oxido-1-azoniabicyclo[2.2.2]octan-3-yl]-3a,4,5,6-tetrahydro-3H-benzo[de]isoquinolin-1-one. InChIKey: IQQIWUDYGYXXEA-BGAFOXLKSA-N.
| Molecular formula | C19H24N2O2 |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | (3aS)-2-[(3S)-1-oxido-1-azoniabicyclo[2.2.2]octan-3-yl]-3a,4,5,6-tetrahydro-3H-benzo[de]isoquinolin-1-one |
| InChIKey | IQQIWUDYGYXXEA-BGAFOXLKSA-N |
| SMILES | C1C[C@@H]2CN(C(=O)C3=CC=CC(=C23)C1)[C@@H]4C[N+]5(CCC4CC5)[O-] |
Computed by PubChem (NCBI)