Pefloxacin (mesylate), 99.73%
cas: 70458-95-6 — see every product listed under this CAS number, including other names
Pefloxacin (mesylate), 99.73% (CAS 70458-95-6) is a chemical reagent available from Chemat. Available pack sizes: 1 g, 5 g, 100 mg, 500 mg, 10mM/1mL, 10 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-B0147A-1 g |
| cas | 70458-95-6 |
| size | 1 g |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 1 g | 621.55 Pln | |
| MedChemExpress | 5 g | 1271.71 Pln | |
| MedChemExpress | 100 mg | 263.96 Pln | |
| MedChemExpress | 500 mg | 454.37 Pln | |
| MedChemExpress | 10mM/1mL | 277.90 Pln | |
| MedChemExpress | 10 g | 1847.57 Pln |
properties
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.73% |
1-ethyl-6-fluoro-7-(4-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid;methanesulfonic acid (CAS 70458-95-6) is a chemical compound with the molecular formula C18H24FN3O6S and a molecular weight of 429.5 g/mol. IUPAC name: 1-ethyl-6-fluoro-7-(4-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid;methanesulfonic acid. InChIKey: HQQSBEDKMRHYME-UHFFFAOYSA-N.
| Molecular formula | C18H24FN3O6S |
|---|---|
| Molecular weight | 429.5 g/mol |
| IUPAC name | 1-ethyl-6-fluoro-7-(4-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid;methanesulfonic acid |
| InChIKey | HQQSBEDKMRHYME-UHFFFAOYSA-N |
| SMILES | CCN1C=C(C(=O)C2=CC(=C(C=C21)N3CCN(CC3)C)F)C(=O)O.CS(=O)(=O)O |
Computed by PubChem (NCBI)