Pentafluorobenzenesulfonyl chloride, 99%
cas: 832-53-1 — see every product listed under this CAS number, including other names
Pentafluorobenzenesulfonyl chloride, 99% (CAS 832-53-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 1g, 10g, 15g, 50g, 100g, 500g. Offered by: Thermo Scientific (Acros), Sigma-Aldrich, Fluorochem.
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 147110050 |
| cas | 832-53-1 |
| size | 5g |
| availability | availability |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 5g | 302.46 Pln | |
| Thermo Scientific (Acros) | 25g | 993.34 Pln | |
| Sigma-Aldrich | 25G | 748.00 Pln | |
| Sigma-Aldrich | 5G | 411.00 Pln | |
| Fluorochem | 1g | 112.48 Pln | |
| Fluorochem | 5g | 227.02 Pln | |
| Fluorochem | 10g | 372.80 Pln | |
| Fluorochem | 15g | 476.93 Pln | |
| Fluorochem | 25g | 617.51 Pln | |
| Fluorochem | 50g | 945.52 Pln | |
| Fluorochem | 100g | 1809.80 Pln | |
| Fluorochem | 500g | 6839.28 Pln |
properties
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 99% |
2,3,4,5,6-pentafluorobenzenesulfonyl chloride (CAS 832-53-1) is a chemical compound with the molecular formula C6ClF5O2S and a molecular weight of 266.57 g/mol. IUPAC name: 2,3,4,5,6-pentafluorobenzenesulfonyl chloride. InChIKey: UOJCTEGNHXRPKO-UHFFFAOYSA-N.
| Molecular formula | C6ClF5O2S |
|---|---|
| Molecular weight | 266.57 g/mol |
| IUPAC name | 2,3,4,5,6-pentafluorobenzenesulfonyl chloride |
| InChIKey | UOJCTEGNHXRPKO-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)S(=O)(=O)Cl)F)F)F |
Computed by PubChem (NCBI)
Synonyms:
Pentafluorobenzenesulfonyl chloride, 2,3,4,5,6-pentafluorobenzenesulfonyl chloride, PFBSC, 2,3,4,5,6-Pentafluorobenzene-1-sulfonyl chloride, Pentafluorobenzenesulphonyl chloride, 2,3,4,5,6-Pentafluorobenzenesulfonyl choride, Benzenesulfonyl chloride, pentafluoro-, C6ClF5O2S, pentafluorobenzene-1-sulfonyl chloride, Pentafluorobenzenesulfonyl chloride, 99%