cas: 771-62-0 — see every product listed under this CAS number, including other names
Pentafluorothiophenol, 97% (CAS 771-62-0) is a chemical reagent available from Chemat. Available pack sizes: 1ML, 5ML, 25ML, 250mg, 1g, 5g, 10g, 25g. Offered by: Thermo Scientific (Acros), Fluorochem.
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 129920010 |
| cas | 771-62-0 |
| size | 1ML |
| availability | availability |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 1ML | 199.56 Pln | |
| Thermo Scientific (Acros) | 5ML | 525.63 Pln | |
| Thermo Scientific (Acros) | 25ML | 1844.14 Pln | |
| Fluorochem | 250mg | 138.51 Pln | |
| Fluorochem | 1g | 154.13 Pln | |
| Fluorochem | 5g | 315.53 Pln | |
| Fluorochem | 10g | 487.35 Pln | |
| Fluorochem | 25g | 1070.47 Pln | |
| Fluorochem | 100g | 2611.60 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
2,3,4,5,6-pentafluorobenzenethiol (CAS 771-62-0) is a chemical compound with the molecular formula C6HF5S and a molecular weight of 200.13 g/mol. IUPAC name: 2,3,4,5,6-pentafluorobenzenethiol. InChIKey: UVAMFBJPMUMURT-UHFFFAOYSA-N.
| Molecular formula | C6HF5S |
|---|---|
| Molecular weight | 200.13 g/mol |
| IUPAC name | 2,3,4,5,6-pentafluorobenzenethiol |
| InChIKey | UVAMFBJPMUMURT-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)S)F)F)F |
Computed by PubChem (NCBI)