cas: 507-63-1 — see every product listed under this CAS number, including other names
Perfluorooctyl Iodide, 98%, 98% (CAS 507-63-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 200g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114TN7-1g |
| cas | 507-63-1 |
| size | 1g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 74.00 Pln | |
| Chemat | 25g | 88.40 Pln | |
| Chemat | 100g | 170.00 Pln | |
| Chemat | 200g | 266.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluoro-8-iodooctane (CAS 507-63-1) is a chemical compound with the molecular formula C8F17I and a molecular weight of 545.96 g/mol. IUPAC name: 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluoro-8-iodooctane. InChIKey: KWXGJTSJUKTDQU-UHFFFAOYSA-N.
| Molecular formula | C8F17I |
|---|---|
| Molecular weight | 545.96 g/mol |
| IUPAC name | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluoro-8-iodooctane |
| InChIKey | KWXGJTSJUKTDQU-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(F)(F)I)(F)F)(F)F)(F)F)(C(C(C(F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)