CAS 376-06-7 appears in our catalog under these names: Perfluorotetradecanoic Acid, Perfluorotetradecanoic Acid (50μg/mL in Methanol), Perfluorotetradecanoic Acid, >95% (HPLC), Perfluorotetradecanoic acid 50 µg/mL in Methanol:Water, PERFLUOROTETRADECANOIC ACID, 96%. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, Sigma-Aldrich, MedChemExpress. Available pack sizes: on request, 1x1ml, 1g, 500mg, 5g, 50mg, 1ml, 10MG.
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-heptacosafluorotetradecanoic acid (CAS 376-06-7) is a chemical compound with the molecular formula C14HF27O2 and a molecular weight of 714.11 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-heptacosafluorotetradecanoic acid. InChIKey: RUDINRUXCKIXAJ-UHFFFAOYSA-N.
| Molecular formula | C14HF27O2 |
|---|---|
| Molecular weight | 714.11 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-heptacosafluorotetradecanoic acid |
| InChIKey | RUDINRUXCKIXAJ-UHFFFAOYSA-N |
| SMILES | C(=O)(C(C(C(C(C(C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O |
Computed by PubChem (NCBI)