cas: 1807521-06-7 — see every product listed under this CAS number, including other names
Ph-Bis(C1-N-(C2-NH-Boc)2) 96% (CAS 1807521-06-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A754590-50mg |
| cas | 1807521-06-7 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 748.62 Pln | |
| Ambeed | 100mg | 1293.75 Pln | |
| Ambeed | 250mg | 2534.19 Pln | |
| Ambeed | 1g | 6227.69 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A754590 |
Tert-butyl N-[2-[[4-[[bis[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]methyl]phenyl]methyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]ethyl]carbamate (CAS 1807521-06-7) is a chemical compound with the molecular formula C36H64N6O8 and a molecular weight of 708.9 g/mol. IUPAC name: tert-butyl N-[2-[[4-[[bis[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]methyl]phenyl]methyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]ethyl]carbamate. InChIKey: CUDDHCKPZHRECU-UHFFFAOYSA-N.
| Molecular formula | C36H64N6O8 |
|---|---|
| Molecular weight | 708.9 g/mol |
| IUPAC name | tert-butyl N-[2-[[4-[[bis[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]methyl]phenyl]methyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]ethyl]carbamate |
| InChIKey | CUDDHCKPZHRECU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCN(CCNC(=O)OC(C)(C)C)CC1=CC=C(C=C1)CN(CCNC(=O)OC(C)(C)C)CCNC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)