cas: 16522-52-4 — see every product listed under this CAS number, including other names
Phenol, 2-(diphenylphosphinyl)-, 95%+, 95%+ (CAS 16522-52-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112W16-50mg |
| cas | 16522-52-4 |
| size | 50mg |
| availability | 0.45g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 2128.40 Pln | |
| Chemat | 100mg | 2819.60 Pln | |
| Chemat | 250mg | 5229.20 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
2-diphenylphosphorylphenol (CAS 16522-52-4) is a chemical compound with the molecular formula C18H15O2P and a molecular weight of 294.3 g/mol. IUPAC name: 2-diphenylphosphorylphenol. InChIKey: XZQDLMWMHRNMDY-UHFFFAOYSA-N.
| Molecular formula | C18H15O2P |
|---|---|
| Molecular weight | 294.3 g/mol |
| IUPAC name | 2-diphenylphosphorylphenol |
| InChIKey | XZQDLMWMHRNMDY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(=O)(C2=CC=CC=C2)C3=CC=CC=C3O |
Computed by PubChem (NCBI)