cas: 1256360-12-9 — see every product listed under this CAS number, including other names
Phenyl(3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrol-1-yl)methanone, 95% (CAS 1256360-12-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F213059-100MG |
| cas | 1256360-12-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 565.44 Pln | |
| Fluorochem | 250mg | 909.07 Pln | |
| Fluorochem | 1g | 2226.32 Pln | |
| Fluorochem | 5g | 7609.84 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Phenyl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrol-1-yl]methanone (CAS 1256360-12-9) is a chemical compound with the molecular formula C17H20BNO3 and a molecular weight of 297.2 g/mol. IUPAC name: phenyl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrol-1-yl]methanone. InChIKey: ODVABAFGSMXFEL-UHFFFAOYSA-N.
| Molecular formula | C17H20BNO3 |
|---|---|
| Molecular weight | 297.2 g/mol |
| IUPAC name | phenyl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrol-1-yl]methanone |
| InChIKey | ODVABAFGSMXFEL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(C=C2)C(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)