cas: 13343-63-0 — see every product listed under this CAS number, including other names
Phenylmethyl 2-(acetylamino)-2-deoxy-4,6-O-(phenylmethylene)-α-D-glucopyranoside (CAS 13343-63-0) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 25 g, 500 mg, 10 g, 1 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W101381-5 g |
| cas | 13343-63-0 |
| size | 5 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 672.64 Pln | |
| MedChemExpress | 25 g | 1847.57 Pln | |
| MedChemExpress | 500 mg | 259.32 Pln | |
| MedChemExpress | 10 g | 983.78 Pln | |
| MedChemExpress | 1 g | 342.91 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | no data |
N-[(4aR,6S,7R,8R,8aS)-8-hydroxy-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide (CAS 13343-63-0) is a chemical compound with the molecular formula C22H25NO6 and a molecular weight of 399.4 g/mol. IUPAC name: N-[(4aR,6S,7R,8R,8aS)-8-hydroxy-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide. InChIKey: NXGXFAKJUWEFEC-NVZUTRPHSA-N.
| Molecular formula | C22H25NO6 |
|---|---|
| Molecular weight | 399.4 g/mol |
| IUPAC name | N-[(4aR,6S,7R,8R,8aS)-8-hydroxy-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide |
| InChIKey | NXGXFAKJUWEFEC-NVZUTRPHSA-N |
| SMILES | CC(=O)N[C@@H]1[C@H]([C@H]2[C@@H](COC(O2)C3=CC=CC=C3)O[C@@H]1OCC4=CC=CC=C4)O |
Computed by PubChem (NCBI)