Phospho(enol)pyruvic acid cyclohexylammonium salt, 98%
cas: 10526-80-4 — see every product listed under this CAS number, including other names
Phospho(enol)pyruvic acid cyclohexylammonium salt, 98% (CAS 10526-80-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A411231-1g |
| cas | 10526-80-4 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 253.56 Pln | |
| Ambeed | 10g | 359.25 Pln | |
| Ambeed | 25g | 748.62 Pln | |
| Ambeed | 100g | 2767.81 Pln | |
| BLDpharm | 1g | 153.30 Pln | |
| BLDpharm | 5g | 269.93 Pln | |
| BLDpharm | 10g | 386.56 Pln | |
| BLDpharm | 25g | 803.08 Pln | |
| BLDpharm | 100g | 2980.09 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Cyclohexanamine;2-phosphonooxyprop-2-enoic acid (CAS 10526-80-4) is a chemical compound with the molecular formula C9H18NO6P and a molecular weight of 267.22 g/mol. IUPAC name: cyclohexanamine;2-phosphonooxyprop-2-enoic acid. InChIKey: VHFCNZDHPABZJO-UHFFFAOYSA-N.
| Molecular formula | C9H18NO6P |
|---|---|
| Molecular weight | 267.22 g/mol |
| IUPAC name | cyclohexanamine;2-phosphonooxyprop-2-enoic acid |
| InChIKey | VHFCNZDHPABZJO-UHFFFAOYSA-N |
| SMILES | C=C(C(=O)O)OP(=O)(O)O.C1CCC(CC1)N |
Computed by PubChem (NCBI)
Synonyms:
2-Propenoic acid, 2-phosphonoxy-, monocyclohexylammonium salt, Cyclohexanamine 2-(phosphonooxy)acrylate, Phospho(enol)pyruvic acid cyclohexylammonium salt, PHOSPHOENOLPYRUVIC ACID CYCLOHEXYLAMMONIUM SALT, Phosphoenolpyruvic Acid Monocyclohexylammonium Salt, Phosphoenolpyruvate, monocyclohexylammonium salt, Phosphoenolpyruvic acid (cyclohexylammonium salt), Phosphoenolpyruvic acid (cyclohexylammoniu?m salt), Phosphoenolpyruvic acid mono(cyclohexylammonium) salt, 2-(Phosphonooxy)-2-propenoic acid monopotassium salt
