cas: 57238-83-2 — see every product listed under this CAS number, including other names
Piperazin-1-yl-p-tolyl-methanone hydrochloride (CAS 57238-83-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F019612-250MG |
| cas | 57238-83-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 435.28 Pln | |
| Fluorochem | 1g | 471.73 Pln |
| delivery time | 2-3 weeks |
|---|
(4-methylphenyl)-piperazin-1-ylmethanone;hydrochloride (CAS 57238-83-2) is a chemical compound with the molecular formula C12H17ClN2O and a molecular weight of 240.73 g/mol. IUPAC name: (4-methylphenyl)-piperazin-1-ylmethanone;hydrochloride. InChIKey: IATKFUZEWGYDMP-UHFFFAOYSA-N.
| Molecular formula | C12H17ClN2O |
|---|---|
| Molecular weight | 240.73 g/mol |
| IUPAC name | (4-methylphenyl)-piperazin-1-ylmethanone;hydrochloride |
| InChIKey | IATKFUZEWGYDMP-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)N2CCNCC2.Cl |
Computed by PubChem (NCBI)