cas: 41717-26-4 — see every product listed under this CAS number, including other names
Piperazine, 1-[(2,4,6-trimethylphenyl)methyl]-, 95%, 95% (CAS 41717-26-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C9B2-100mg |
| cas | 41717-26-4 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 381.20 Pln | |
| Chemat | 250mg | 592.40 Pln | |
| Chemat | 500mg | 947.60 Pln | |
| Chemat | 1g | 1394.00 Pln | |
| Chemat | 5g | 4053.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-[(2,4,6-trimethylphenyl)methyl]piperazine (CAS 41717-26-4) is a chemical compound with the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. IUPAC name: 1-[(2,4,6-trimethylphenyl)methyl]piperazine. InChIKey: FOERNUXLFALRDN-UHFFFAOYSA-N.
| Molecular formula | C14H22N2 |
|---|---|
| Molecular weight | 218.34 g/mol |
| IUPAC name | 1-[(2,4,6-trimethylphenyl)methyl]piperazine |
| InChIKey | FOERNUXLFALRDN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)CN2CCNCC2)C |
Computed by PubChem (NCBI)