cas: 154057-56-4 — see every product listed under this CAS number, including other names
Pitavastatin impurity 1, 98.86% (CAS 154057-56-4) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 25 g, 50 g, 1 g, 100 g, 10 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-Z3150-5 g |
| cas | 154057-56-4 |
| size | 5 g |
| availability | In stock |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 361.49 Pln | |
| MedChemExpress | 25 g | 816.60 Pln | |
| MedChemExpress | 50 g | 1225.27 Pln | |
| MedChemExpress | 1 g | 240.74 Pln | |
| MedChemExpress | 100 g | 1884.72 Pln | |
| MedChemExpress | 10 g | 477.59 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 98.86% |
3-(bromomethyl)-2-cyclopropyl-4-(4-fluorophenyl)quinoline (CAS 154057-56-4) is a chemical compound with the molecular formula C19H15BrFN and a molecular weight of 356.2 g/mol. IUPAC name: 3-(bromomethyl)-2-cyclopropyl-4-(4-fluorophenyl)quinoline. InChIKey: QCNHMJKMLPPGMF-UHFFFAOYSA-N.
| Molecular formula | C19H15BrFN |
|---|---|
| Molecular weight | 356.2 g/mol |
| IUPAC name | 3-(bromomethyl)-2-cyclopropyl-4-(4-fluorophenyl)quinoline |
| InChIKey | QCNHMJKMLPPGMF-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NC3=CC=CC=C3C(=C2CBr)C4=CC=C(C=C4)F |
Computed by PubChem (NCBI)