CAS 321688-88-4 appears in our catalog under these names: Poloxin, Poloxin/ 99.19% (existing batch purity), Poloxin, 96%, 96%, Poloxin, 98.05%. Offered by: TRC, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 250mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso), 5mg.
[(Z)-(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] 2-methylbenzoate (CAS 321688-88-4) is a chemical compound with the molecular formula C18H19NO3 and a molecular weight of 297.3 g/mol. IUPAC name: [(Z)-(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] 2-methylbenzoate. InChIKey: CMOJHDQJJPIVEC-MNDPQUGUSA-N.
| Molecular formula | C18H19NO3 |
|---|---|
| Molecular weight | 297.3 g/mol |
| IUPAC name | [(Z)-(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] 2-methylbenzoate |
| InChIKey | CMOJHDQJJPIVEC-MNDPQUGUSA-N |
| SMILES | CC1=CC=CC=C1C(=O)O/N=C\2/C=C(C(=O)C=C2C)C(C)C |
Computed by PubChem (NCBI)