cas: 2254447-10-2 — see every product listed under this CAS number, including other names
Potassium ((1-[(tert-butoxy)carbonyl]azetidin-3-yl)methyl)trifluoroboranuide, 95%, 95% (CAS 2254447-10-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JWFV-100mg |
| cas | 2254447-10-2 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 266.00 Pln | |
| Chemat | 250mg | 414.80 Pln | |
| Chemat | 1g | 976.40 Pln | |
| Chemat | 5g | 3266.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Potassium trifluoro-[[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]methyl]boranuide (CAS 2254447-10-2) is a chemical compound with the molecular formula C9H16BF3KNO2 and a molecular weight of 277.14 g/mol. IUPAC name: potassium trifluoro-[[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]methyl]boranuide. InChIKey: RFYIUAKJQXQXST-UHFFFAOYSA-N.
| Molecular formula | C9H16BF3KNO2 |
|---|---|
| Molecular weight | 277.14 g/mol |
| IUPAC name | potassium trifluoro-[[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]methyl]boranuide |
| InChIKey | RFYIUAKJQXQXST-UHFFFAOYSA-N |
| SMILES | [B-](CC1CN(C1)C(=O)OC(C)(C)C)(F)(F)F.[K+] |
Computed by PubChem (NCBI)